nuranati1506 nuranati1506

18-03-2024
Chemistry

contestada

Is CH3CH2CH(CH3CH2)CH(CH3)CH2(CH3) 3-ethyl-4,5-dimethylpentane ?

Respuesta :

bb2533745 bb2533745

18-03-2024

Answer:

yed it's true

Explanation:

or else 1,2-dimethyl-3-ethylpentane

Answer Link

Otras preguntas

Which pronoun best completes the sentence? How is the pronoun used? Send Gus and __________ the details in an email. a. me: direct object b. me: indirect obje

Carter needs to wrap 7 presents. He lays the ribbon out flat and says , " If I make 6 equal cuts, I'll have just enough pieces I can use one piece for each pack

Which of the following direction words asks you to make a judgment about the effectiveness and success of a subject? a. Analize b. Evaluate c. Contrast d. I

Which of the following is not a leading urban center in Venezuela? a. Salvador b. Caracas c. Maracaibo d. Valencia

How have technological advances in transportation made migration easier, from the Age of Exploration to modern times?

homo erectus is known for which of the following discoveries? a. fire b. money c. plow d. wheel

three examples of itself

A drug trial is testing the effectiveness of two drugs. If 50 patients are given Drug A, 20 patients are given Drug B, and 100 patients are given a placebo, wha

In 1948–1949, the city of Berlin was blockaded by Soviet forces. Which sectors of the city were supplied by the airlift? British, West German, American French,

Some invertebrates in Antarctica have which compound in their blood to help protect against the cold