mneidhardt01 mneidhardt01

18-03-2016
Mathematics

contestada

What's a Absolute value equation that equals 7 and 11?

Respuesta :

Аноним Аноним

19-03-2016

for 7 it could be |-7|=7 or |7|=7 , for 11 it could be |-11|=11 or |11|=11

Answer Link

Otras preguntas

Jeanie completed a 27 mile duathlon (a race that is a combination of running and biking) in exactly 2 hours. she ran an average speed of 8.5 miles per hour and

What is the net ionic equation for this reaction? Na+(aq) + C2H3O2–(aq) + H+(aq) + Cl– (aq) → Na+(aq) + Cl– (aq) + HC2H3O2(aq)

Label the notes please!!first one to answer all gets marked as a brainilst. Thanks 15 points

Amnesty international, an association that exposes human rights violations and attempts to influence the united states to curb such abuses, is an example of wha

which of the following equations shows direct variations a) y= x/3 + 1 B) y= 3x c) Y=3/x

¿Qué le pasó a Sonia Sotomayor cuando tenía 9 años? Se mudó a Puerto Rico. Su padre se murió. Se mudó al Bronx. Su hermano se murió.

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

Do convolutional neural networks act as compositional nearest neighbors?

Find the slope of the line that passes through (66, 77) and (-3, -10).

"what is the term used for the leader of a turkish state?"